C20H28N6OS3 — CID 23390924
N-[5-[butan-2-yl(prop-2-enyl)amino]-2-[[5-(2-methylsulfanylethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide (PubChem CID 23390924) has the molecular formula C20H28N6OS3 and a molecular weight of 464.69 g/mol. Its IUPAC name is N-[5-[butan-2-yl(prop-2-enyl)amino]-2-[[5-(2-methylsulfanylethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide.
| Compound Name | N-[5-[butan-2-yl(prop-2-enyl)amino]-2-[[5-(2-methylsulfanylethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23390924 |
| Molecular Formula | C20H28N6OS3 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[5-[butan-2-yl(prop-2-enyl)amino]-2-[[5-(2-methylsulfanylethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide |
| SMILES | C=CCN(c1ccc(/N=N/c2nnc(SCCSC)s2)c(NC(C)=O)c1)C(C)CC |
| InChI | InChI=1S/C20H28N6OS3/c1-6-10-26(14(3)7-2)16-8-9-17(18(13-16)21-15(4)27)22-23-19-24-25-20(30-19)29-12-11-28-5/h6,8-9,13-14H,1,7,10-12H2,2-5H3,(H,21,27)/b23-22+ |
| InChIKey | JEPCPOQYNQCIED-GHVJWSGMSA-N |
| XLogP | 6.16 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|