About (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate
(3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate (PubChem CID 23391176) has the molecular formula C22H22F4O2
and a molecular weight of 394.41 g/mol. Its IUPAC name is (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate.
Molecular Properties
| Compound Name | (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate |
| PubChem CID | 23391176 |
| Molecular Formula | C22H22F4O2 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2cc(F)c(C(=O)Oc3ccc(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C22H22F4O2/c1-2-3-13-4-6-14(7-5-13)15-10-19(25)21(20(26)11-15)22(27)28-16-8-9-17(23)18(24)12-16/h8-14H,2-7H2,1H3 |
| InChIKey | PWCOSNNNJUHMGD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate?
The IUPAC name of (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate (CID 23391176) is (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate.
What is the SMILES notation for (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate?
The canonical SMILES for (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate is CCCC1CCC(c2cc(F)c(C(=O)Oc3ccc(F)c(F)c3)c(F)c2)CC1.
What is the InChIKey of (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate?
The InChIKey is PWCOSNNNJUHMGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F4O2/c1-2-3-13-4-6-14(7-5-13)15-10-19(25)21(20(26)11-15)22(27)28-16-8-9-17(23)18(24)12-16/h8-14H,2-7H2,1H3.
What are the key properties of (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate?
(3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate has a molecular weight of 394.41 g/mol, XLogP of 6.54, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluorophenyl) 2,6-difluoro-4-(4-propylcyclohexyl)benzoate is sourced from PubChem (CID 23391176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).