(4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate

C17H23FO3 — CID 23391227

IUPAC(4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate
SMILESCCCCOC1CCC(C(=O)Oc2ccc(F)cc2)CC1
InChIInChI=1S/C17H23FO3/c1-2-3-12-20-15-8-4-13(5-9-15)17(19)21-16-10-6-14(18)7-11-16/h6-7,10-11,13,15H,2-5,8-9,12H2,1H3
InChIKeyBZCVHZAADFWICK-UHFFFAOYSA-N
MW294.37 g/mol
LogP4.11
Rot. Bonds6

About (4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate

(4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate (PubChem CID 23391227) has the molecular formula C17H23FO3 and a molecular weight of 294.37 g/mol. Its IUPAC name is (4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate.

Molecular Properties

Compound Name(4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate
PubChem CID23391227
Molecular FormulaC17H23FO3
Molecular Weight294.37 g/mol
Exact Mass294.16
IUPAC Name(4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate
SMILESCCCCOC1CCC(C(=O)Oc2ccc(F)cc2)CC1
InChIInChI=1S/C17H23FO3/c1-2-3-12-20-15-8-4-13(5-9-15)17(19)21-16-10-6-14(18)7-11-16/h6-7,10-11,13,15H,2-5,8-9,12H2,1H3
InChIKeyBZCVHZAADFWICK-UHFFFAOYSA-N
XLogP4.11
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.37
LogP ≤ 54.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate?
The IUPAC name of (4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate (CID 23391227) is (4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate.
What is the SMILES notation for (4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate?
The canonical SMILES for (4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate is CCCCOC1CCC(C(=O)Oc2ccc(F)cc2)CC1.
What is the InChIKey of (4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate?
The InChIKey is BZCVHZAADFWICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23FO3/c1-2-3-12-20-15-8-4-13(5-9-15)17(19)21-16-10-6-14(18)7-11-16/h6-7,10-11,13,15H,2-5,8-9,12H2,1H3.
What are the key properties of (4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate?
(4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate has a molecular weight of 294.37 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) 4-butoxycyclohexane-1-carboxylate is sourced from PubChem (CID 23391227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).