C16H18S2Si — CID 23391258
2-[1,1-dimethyl-5-(5-methylthiophen-2-yl)silol-2-yl]-5-methylthiophene (PubChem CID 23391258) has the molecular formula C16H18S2Si and a molecular weight of 302.54 g/mol. Its IUPAC name is 2-[1,1-dimethyl-5-(5-methylthiophen-2-yl)silol-2-yl]-5-methylthiophene.
| Compound Name | 2-[1,1-dimethyl-5-(5-methylthiophen-2-yl)silol-2-yl]-5-methylthiophene |
|---|---|
| PubChem CID | 23391258 |
| Molecular Formula | C16H18S2Si |
| Molecular Weight | 302.54 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-[1,1-dimethyl-5-(5-methylthiophen-2-yl)silol-2-yl]-5-methylthiophene |
| SMILES | Cc1ccc(C2=CC=C(c3ccc(C)s3)[Si]2(C)C)s1 |
| InChI | InChI=1S/C16H18S2Si/c1-11-5-7-13(17-11)15-9-10-16(19(15,3)4)14-8-6-12(2)18-14/h5-10H,1-4H3 |
| InChIKey | HRXJKMHWXVGVPL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|