C42H12F15N9 — CID 23391288
2-[3,5-bis[3-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-b]pyridin-2-yl]phenyl]-3-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-b]pyridine (PubChem CID 23391288) has the molecular formula C42H12F15N9 and a molecular weight of 927.59 g/mol. Its IUPAC name is 2-[3,5-bis[3-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-b]pyridin-2-yl]phenyl]-3-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-[3,5-bis[3-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-b]pyridin-2-yl]phenyl]-3-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 23391288 |
| Molecular Formula | C42H12F15N9 |
| Molecular Weight | 927.59 g/mol |
| Exact Mass | 927.10 |
| IUPAC Name | 2-[3,5-bis[3-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-b]pyridin-2-yl]phenyl]-3-(2,3,4,5,6-pentafluorophenyl)imidazo[4,5-b]pyridine |
| SMILES | Fc1c(F)c(F)c(-n2c(-c3cc(-c4nc5cccnc5n4-c4c(F)c(F)c(F)c(F)c4F)cc(-c4nc5cccnc5n4-c4c(F)c(F)c(F)c(F)c4F)c3)nc3cccnc32)c(F)c1F |
| InChI | InChI=1S/C42H12F15N9/c43-19-22(46)28(52)34(29(53)23(19)47)64-37(61-16-4-1-7-58-40(16)64)13-10-14(38-62-17-5-2-8-59-41(17)65(38)35-30(54)24(48)20(44)25(49)31(35)55)12-15(11-13)39-63-18-6-3-9-60-42(18)66(39)36-32(56)26(50)21(45)27(51)33(36)57/h1-12H |
| InChIKey | JMOJAAJPICGUEO-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.59 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|