C78H42N12S6 — CID 23391317
2-[4-[2,3,4,5,6-pentakis[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 23391317) has the molecular formula C78H42N12S6 and a molecular weight of 1339.68 g/mol. Its IUPAC name is 2-[4-[2,3,4,5,6-pentakis[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-[4-[2,3,4,5,6-pentakis[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 23391317 |
| Molecular Formula | C78H42N12S6 |
| Molecular Weight | 1339.68 g/mol |
| Exact Mass | 1338.20 |
| IUPAC Name | 2-[4-[2,3,4,5,6-pentakis[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | c1cnc2sc(-c3ccc(-c4c(-c5ccc(-c6nc7cccnc7s6)cc5)c(-c5ccc(-c6nc7cccnc7s6)cc5)c(-c5ccc(-c6nc7cccnc7s6)cc5)c(-c5ccc(-c6nc7cccnc7s6)cc5)c4-c4ccc(-c5nc6cccnc6s5)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C78H42N12S6/c1-7-55-73(79-37-1)91-67(85-55)49-25-13-43(14-26-49)61-62(44-15-27-50(28-16-44)68-86-56-8-2-38-80-74(56)92-68)64(46-19-31-52(32-20-46)70-88-58-10-4-40-82-76(58)94-70)66(48-23-35-54(36-24-48)72-90-60-12-6-42-84-78(60)96-72)65(47-21-33-53(34-22-47)71-89-59-11-5-41-83-77(59)95-71)63(61)45-17-29-51(30-18-45)69-87-57-9-3-39-81-75(57)93-69/h1-42H |
| InChIKey | AAJFUVFNJMJXMC-UHFFFAOYSA-N |
| XLogP | 21.72 |
| TPSA | 154.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1339.68 |
| LogP ≤ 5 | 21.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |