About [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate
[3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate (PubChem CID 23391593) has the molecular formula C21H25O9P-2
and a molecular weight of 452.40 g/mol. Its IUPAC name is [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate.
Molecular Properties
| Compound Name | [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate |
| PubChem CID | 23391593 |
| Molecular Formula | C21H25O9P-2 |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate |
| SMILES | O=C(O)CCCOC1(c2cccc(OP(=O)([O-])[O-])c2)OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C21H27O9P/c22-19(23)5-2-6-27-21(15-3-1-4-18(12-15)28-31(24,25)26)20(29-30-21)16-8-13-7-14(10-16)11-17(20)9-13/h1,3-4,12-14,16-17H,2,5-11H2,(H,22,23)(H2,24,25,26)/p-2 |
| InChIKey | NXYPMGLWQZZOPP-UHFFFAOYSA-L |
| XLogP | 2.09 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate?
The IUPAC name of [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate (CID 23391593) is [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate.
What is the SMILES notation for [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate?
The canonical SMILES for [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate is O=C(O)CCCOC1(c2cccc(OP(=O)([O-])[O-])c2)OOC12C1CC3CC(C1)CC2C3.
What is the InChIKey of [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate?
The InChIKey is NXYPMGLWQZZOPP-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H27O9P/c22-19(23)5-2-6-27-21(15-3-1-4-18(12-15)28-31(24,25)26)20(29-30-21)16-8-13-7-14(10-16)11-17(20)9-13/h1,3-4,12-14,16-17H,2,5-11H2,(H,22,23)(H2,24,25,26)/p-2.
What are the key properties of [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate?
[3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate has a molecular weight of 452.40 g/mol, XLogP of 2.09, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3'-(3-carboxypropoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] phosphate is sourced from PubChem (CID 23391593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).