About cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate
cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate (PubChem CID 23391721) has the molecular formula C22H38N2O5
and a molecular weight of 410.56 g/mol. Its IUPAC name is cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate |
| PubChem CID | 23391721 |
| Molecular Formula | C22H38N2O5 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate |
| SMILES | C=CCC(C(=O)NO)C(CC(C)C)C(=O)NC(C(=O)OC1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C22H38N2O5/c1-7-10-16(20(26)24-28)17(13-14(2)3)19(25)23-18(22(4,5)6)21(27)29-15-11-8-9-12-15/h7,14-18,28H,1,8-13H2,2-6H3,(H,23,25)(H,24,26) |
| InChIKey | ORBFGCDUALWZFX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate?
The IUPAC name of cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate (CID 23391721) is cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate.
What is the SMILES notation for cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate?
The canonical SMILES for cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate is C=CCC(C(=O)NO)C(CC(C)C)C(=O)NC(C(=O)OC1CCCC1)C(C)(C)C.
What is the InChIKey of cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate?
The InChIKey is ORBFGCDUALWZFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38N2O5/c1-7-10-16(20(26)24-28)17(13-14(2)3)19(25)23-18(22(4,5)6)21(27)29-15-11-8-9-12-15/h7,14-18,28H,1,8-13H2,2-6H3,(H,23,25)(H,24,26).
What are the key properties of cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate?
cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate has a molecular weight of 410.56 g/mol, XLogP of 3.36, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl 2-[[3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate is sourced from PubChem (CID 23391721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).