C19H20F6N2O2 — CID 23391833
(2R,3R)-2,3-dimethyl-7-propan-2-yloxy-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-2,3-dihydropyrido[3,2-g][1,4]benzoxazine (PubChem CID 23391833) has the molecular formula C19H20F6N2O2 and a molecular weight of 422.37 g/mol. Its IUPAC name is (2R,3R)-2,3-dimethyl-7-propan-2-yloxy-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-2,3-dihydropyrido[3,2-g][1,4]benzoxazine.
| Compound Name | (2R,3R)-2,3-dimethyl-7-propan-2-yloxy-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-2,3-dihydropyrido[3,2-g][1,4]benzoxazine |
|---|---|
| PubChem CID | 23391833 |
| Molecular Formula | C19H20F6N2O2 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (2R,3R)-2,3-dimethyl-7-propan-2-yloxy-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-2,3-dihydropyrido[3,2-g][1,4]benzoxazine |
| SMILES | CC(C)Oc1cc(C(F)(F)F)c2cc3c(cc2n1)O[C@H](C)[C@@H](C)N3CC(F)(F)F |
| InChI | InChI=1S/C19H20F6N2O2/c1-9(2)28-17-6-13(19(23,24)25)12-5-15-16(7-14(12)26-17)29-11(4)10(3)27(15)8-18(20,21)22/h5-7,9-11H,8H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | CVXFVJIGARERRW-GHMZBOCLSA-N |
| XLogP | 5.58 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |