C9H14N2O — CID 23391843
1-N-ethyl-2-methoxybenzene-1,4-diamine (PubChem CID 23391843) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-N-ethyl-2-methoxybenzene-1,4-diamine.
| Compound Name | 1-N-ethyl-2-methoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 23391843 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-N-ethyl-2-methoxybenzene-1,4-diamine |
| SMILES | CCNc1ccc(N)cc1OC |
| InChI | InChI=1S/C9H14N2O/c1-3-11-8-5-4-7(10)6-9(8)12-2/h4-6,11H,3,10H2,1-2H3 |
| InChIKey | WQXZLNLWAKSNDJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|