C10H15ClN6O2S — CID 23391936
(NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-ethyl-3-methyl-1,3,5-triazinan-2-ylidene]nitramide (PubChem CID 23391936) has the molecular formula C10H15ClN6O2S and a molecular weight of 318.79 g/mol. Its IUPAC name is (NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-ethyl-3-methyl-1,3,5-triazinan-2-ylidene]nitramide.
| Compound Name | (NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-ethyl-3-methyl-1,3,5-triazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 23391936 |
| Molecular Formula | C10H15ClN6O2S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (NZ)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-ethyl-3-methyl-1,3,5-triazinan-2-ylidene]nitramide |
| SMILES | CCN1CN(C)/C(=N/[N+](=O)[O-])N(Cc2cnc(Cl)s2)C1 |
| InChI | InChI=1S/C10H15ClN6O2S/c1-3-15-6-14(2)10(13-17(18)19)16(7-15)5-8-4-12-9(11)20-8/h4H,3,5-7H2,1-2H3/b13-10- |
| InChIKey | WFDLASOOKGHPOO-RAXLEYEMSA-N |
| XLogP | 1.33 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|