About 3,4-dichloro-1,5-dimethylpyrazole
3,4-dichloro-1,5-dimethylpyrazole (PubChem CID 23392053) has the molecular formula C5H6Cl2N2
and a molecular weight of 165.02 g/mol. Its IUPAC name is 3,4-dichloro-1,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 3,4-dichloro-1,5-dimethylpyrazole |
| PubChem CID | 23392053 |
| Molecular Formula | C5H6Cl2N2 |
| Molecular Weight | 165.02 g/mol |
| Exact Mass | 163.99 |
| IUPAC Name | 3,4-dichloro-1,5-dimethylpyrazole |
| SMILES | Cc1c(Cl)c(Cl)nn1C |
| InChI | InChI=1S/C5H6Cl2N2/c1-3-4(6)5(7)8-9(3)2/h1-2H3 |
| InChIKey | OIVXURMADAJFFQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.02 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dichloro-1,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-1,5-dimethylpyrazole?
The IUPAC name of 3,4-dichloro-1,5-dimethylpyrazole (CID 23392053) is 3,4-dichloro-1,5-dimethylpyrazole.
What is the SMILES notation for 3,4-dichloro-1,5-dimethylpyrazole?
The canonical SMILES for 3,4-dichloro-1,5-dimethylpyrazole is Cc1c(Cl)c(Cl)nn1C.
What is the InChIKey of 3,4-dichloro-1,5-dimethylpyrazole?
The InChIKey is OIVXURMADAJFFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6Cl2N2/c1-3-4(6)5(7)8-9(3)2/h1-2H3.
What are the key properties of 3,4-dichloro-1,5-dimethylpyrazole?
3,4-dichloro-1,5-dimethylpyrazole has a molecular weight of 165.02 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-1,5-dimethylpyrazole is sourced from PubChem (CID 23392053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).