C22H22O2 — CID 23392377
3a-(2,2-diphenylethyl)-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one (PubChem CID 23392377) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 3a-(2,2-diphenylethyl)-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one.
| Compound Name | 3a-(2,2-diphenylethyl)-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 23392377 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3a-(2,2-diphenylethyl)-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one |
| SMILES | C=C1CC2COC(=O)C2(CC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C22H22O2/c1-16-12-19-15-24-21(23)22(19,13-16)14-20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,19-20H,1,12-15H2 |
| InChIKey | QTKTXOVLBHAIIR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|