C15H14F2O2 — CID 23392384
3a-[(2,6-difluorophenyl)methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one (PubChem CID 23392384) has the molecular formula C15H14F2O2 and a molecular weight of 264.27 g/mol. Its IUPAC name is 3a-[(2,6-difluorophenyl)methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one.
| Compound Name | 3a-[(2,6-difluorophenyl)methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 23392384 |
| Molecular Formula | C15H14F2O2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3a-[(2,6-difluorophenyl)methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one |
| SMILES | C=C1CC2COC(=O)C2(Cc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C15H14F2O2/c1-9-5-10-8-19-14(18)15(10,6-9)7-11-12(16)3-2-4-13(11)17/h2-4,10H,1,5-8H2 |
| InChIKey | RWMIMEGRTNAQIE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|