C15H15FO2 — CID 23392405
3a-[(3-fluorophenyl)methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one (PubChem CID 23392405) has the molecular formula C15H15FO2 and a molecular weight of 246.28 g/mol. Its IUPAC name is 3a-[(3-fluorophenyl)methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one.
| Compound Name | 3a-[(3-fluorophenyl)methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 23392405 |
| Molecular Formula | C15H15FO2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3a-[(3-fluorophenyl)methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one |
| SMILES | C=C1CC2COC(=O)C2(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C15H15FO2/c1-10-5-12-9-18-14(17)15(12,7-10)8-11-3-2-4-13(16)6-11/h2-4,6,12H,1,5,7-9H2 |
| InChIKey | YKIJCMQZBLYANG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|