C18H20O4 — CID 23392491
ethyl 4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]benzoate (PubChem CID 23392491) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is ethyl 4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]benzoate.
| Compound Name | ethyl 4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]benzoate |
|---|---|
| PubChem CID | 23392491 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | ethyl 4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]benzoate |
| SMILES | C=C1CC2COC(=O)C2(Cc2ccc(C(=O)OCC)cc2)C1 |
| InChI | InChI=1S/C18H20O4/c1-3-21-16(19)14-6-4-13(5-7-14)10-18-9-12(2)8-15(18)11-22-17(18)20/h4-7,15H,2-3,8-11H2,1H3 |
| InChIKey | NUILFRZIGXSLCT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|