C23H20Cl3NO3 — CID 23392555
N-[4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl]-2-(2,4,6-trichlorophenyl)acetamide (PubChem CID 23392555) has the molecular formula C23H20Cl3NO3 and a molecular weight of 464.78 g/mol. Its IUPAC name is N-[4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl]-2-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | N-[4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl]-2-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 23392555 |
| Molecular Formula | C23H20Cl3NO3 |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | N-[4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl]-2-(2,4,6-trichlorophenyl)acetamide |
| SMILES | C=C1CC2COC(=O)C2(Cc2ccc(NC(=O)Cc3c(Cl)cc(Cl)cc3Cl)cc2)C1 |
| InChI | InChI=1S/C23H20Cl3NO3/c1-13-6-15-12-30-22(29)23(15,10-13)11-14-2-4-17(5-3-14)27-21(28)9-18-19(25)7-16(24)8-20(18)26/h2-5,7-8,15H,1,6,9-12H2,(H,27,28) |
| InChIKey | AJSFSCXMZVKQQM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|