C26H16N4O4 — CID 23392746
7,18-bis(aminomethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 23392746) has the molecular formula C26H16N4O4 and a molecular weight of 448.44 g/mol. Its IUPAC name is 7,18-bis(aminomethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 7,18-bis(aminomethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 23392746 |
| Molecular Formula | C26H16N4O4 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 7,18-bis(aminomethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | NCN1C(=O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C1=O)c64)C(=O)N(CN)C5=O |
| InChI | InChI=1S/C26H16N4O4/c27-9-29-23(31)15-5-1-11-12-2-6-17-22-18(26(34)30(10-28)25(17)33)8-4-14(20(12)22)13-3-7-16(24(29)32)21(15)19(11)13/h1-8H,9-10,27-28H2 |
| InChIKey | GPEYRGIUHFQLSV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|