C30H36N2O6 — CID 23392942
(2S,3S,4S)-1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 23392942) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is (2S,3S,4S)-1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3S,4S)-1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 23392942 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (2S,3S,4S)-1-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)N2CCC3CCCCC3C2)cc1 |
| InChI | InChI=1S/C30H36N2O6/c1-36-23-9-6-20(7-10-23)29-28(30(34)35)24(21-8-11-25-26(14-21)38-18-37-25)16-32(29)17-27(33)31-13-12-19-4-2-3-5-22(19)15-31/h6-11,14,19,22,24,28-29H,2-5,12-13,15-18H2,1H3,(H,34,35)/t19?,22?,24-,28+,29-/m1/s1 |
| InChIKey | MFLHRWMQAQAQID-JVTCEZKASA-N |
| XLogP | 4.30 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |