C23H44N4O3 — CID 23393137
N'-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanediamide (PubChem CID 23393137) has the molecular formula C23H44N4O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is N'-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanediamide.
| Compound Name | N'-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanediamide |
|---|---|
| PubChem CID | 23393137 |
| Molecular Formula | C23H44N4O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | N'-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanediamide |
| SMILES | CON1C(C)(C)CC(NC(=O)CC(=O)NC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C23H44N4O3/c1-20(2)12-16(13-21(3,4)26(20)9)24-18(28)11-19(29)25-17-14-22(5,6)27(30-10)23(7,8)15-17/h16-17H,11-15H2,1-10H3,(H,24,28)(H,25,29) |
| InChIKey | DWYMZLOJANQDIR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|