C33H46O11 — CID 23393170
[[5-acetyloxy-2-(2-acetyloxypropanoyl)-6-hydroxy-6-(hydroxymethyl)-2,3-dimethylcyclohexyl]-(1,5-dihydroxy-2,2,4-trimethylcyclohex-3-en-1-yl)methyl] benzoate (PubChem CID 23393170) has the molecular formula C33H46O11 and a molecular weight of 618.72 g/mol. Its IUPAC name is [[5-acetyloxy-2-(2-acetyloxypropanoyl)-6-hydroxy-6-(hydroxymethyl)-2,3-dimethylcyclohexyl]-(1,5-dihydroxy-2,2,4-trimethylcyclohex-3-en-1-yl)methyl] benzoate.
| Compound Name | [[5-acetyloxy-2-(2-acetyloxypropanoyl)-6-hydroxy-6-(hydroxymethyl)-2,3-dimethylcyclohexyl]-(1,5-dihydroxy-2,2,4-trimethylcyclohex-3-en-1-yl)methyl] benzoate |
|---|---|
| PubChem CID | 23393170 |
| Molecular Formula | C33H46O11 |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | [[5-acetyloxy-2-(2-acetyloxypropanoyl)-6-hydroxy-6-(hydroxymethyl)-2,3-dimethylcyclohexyl]-(1,5-dihydroxy-2,2,4-trimethylcyclohex-3-en-1-yl)methyl] benzoate |
| SMILES | CC(=O)OC(C)C(=O)C1(C)C(C)CC(OC(C)=O)C(O)(CO)C1C(OC(=O)c1ccccc1)C1(O)CC(O)C(C)=CC1(C)C |
| InChI | InChI=1S/C33H46O11/c1-18-15-30(6,7)33(41,16-24(18)37)28(44-29(39)23-12-10-9-11-13-23)26-31(8,27(38)20(3)42-21(4)35)19(2)14-25(43-22(5)36)32(26,40)17-34/h9-13,15,19-20,24-26,28,34,37,40-41H,14,16-17H2,1-8H3 |
| InChIKey | GCBDTOWEYBTTRW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|