C23H33F9O4 — CID 23393217
tert-butyl 4-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxy-3-methyl-2-bicyclo[2.2.1]heptanyl]-2,4-dimethyl-2-(trifluoromethyl)pentanoate (PubChem CID 23393217) has the molecular formula C23H33F9O4 and a molecular weight of 544.50 g/mol. Its IUPAC name is tert-butyl 4-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxy-3-methyl-2-bicyclo[2.2.1]heptanyl]-2,4-dimethyl-2-(trifluoromethyl)pentanoate.
| Compound Name | tert-butyl 4-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxy-3-methyl-2-bicyclo[2.2.1]heptanyl]-2,4-dimethyl-2-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 23393217 |
| Molecular Formula | C23H33F9O4 |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | tert-butyl 4-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxy-3-methyl-2-bicyclo[2.2.1]heptanyl]-2,4-dimethyl-2-(trifluoromethyl)pentanoate |
| SMILES | CC1C2CC(OC(O)(C(F)(F)F)C(F)(F)F)C(C2)C1C(C)(C)CC(C)(C(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C23H33F9O4/c1-11-12-8-13(14(9-12)35-20(34,22(27,28)29)23(30,31)32)15(11)18(5,6)10-19(7,21(24,25)26)16(33)36-17(2,3)4/h11-15,34H,8-10H2,1-7H3 |
| InChIKey | MUYIZKQGPTZEBE-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|