C16H17N3O4 — CID 23393306
[(3-nitro-2-phenoxy-5,6,7,8-tetrahydroquinolin-4-yl)amino]methanol (PubChem CID 23393306) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is [(3-nitro-2-phenoxy-5,6,7,8-tetrahydroquinolin-4-yl)amino]methanol.
| Compound Name | [(3-nitro-2-phenoxy-5,6,7,8-tetrahydroquinolin-4-yl)amino]methanol |
|---|---|
| PubChem CID | 23393306 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | [(3-nitro-2-phenoxy-5,6,7,8-tetrahydroquinolin-4-yl)amino]methanol |
| SMILES | O=[N+]([O-])c1c(Oc2ccccc2)nc2c(c1NCO)CCCC2 |
| InChI | InChI=1S/C16H17N3O4/c20-10-17-14-12-8-4-5-9-13(12)18-16(15(14)19(21)22)23-11-6-2-1-3-7-11/h1-3,6-7,20H,4-5,8-10H2,(H,17,18) |
| InChIKey | JUWOEGPNEOWJJM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|