C24H23ClN2O2 — CID 23393328
2-(7-chloro-1,8-naphthyridin-2-yl)-3-(5-methyl-2-oxohexyl)-2,3-dihydroinden-1-one (PubChem CID 23393328) has the molecular formula C24H23ClN2O2 and a molecular weight of 406.91 g/mol. Its IUPAC name is 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(5-methyl-2-oxohexyl)-2,3-dihydroinden-1-one.
| Compound Name | 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(5-methyl-2-oxohexyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 23393328 |
| Molecular Formula | C24H23ClN2O2 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(5-methyl-2-oxohexyl)-2,3-dihydroinden-1-one |
| SMILES | CC(C)CCC(=O)CC1c2ccccc2C(=O)C1c1ccc2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C24H23ClN2O2/c1-14(2)7-10-16(28)13-19-17-5-3-4-6-18(17)23(29)22(19)20-11-8-15-9-12-21(25)27-24(15)26-20/h3-6,8-9,11-12,14,19,22H,7,10,13H2,1-2H3 |
| InChIKey | GTRRDPXGWKAFQI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|