About 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine
2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine (PubChem CID 23393370) has the molecular formula C21H23F3N2O3S
and a molecular weight of 440.49 g/mol. Its IUPAC name is 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine |
| PubChem CID | 23393370 |
| Molecular Formula | C21H23F3N2O3S |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine |
| SMILES | O=S(=O)(c1ccc(OCCCCN2CC=CCC2)cc1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C21H23F3N2O3S/c22-21(23,24)17-6-11-20(25-16-17)30(27,28)19-9-7-18(8-10-19)29-15-5-4-14-26-12-2-1-3-13-26/h1-2,6-11,16H,3-5,12-15H2 |
| InChIKey | ZBXWJSYVNHKMDP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine?
The IUPAC name of 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine (CID 23393370) is 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine?
The canonical SMILES for 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine is O=S(=O)(c1ccc(OCCCCN2CC=CCC2)cc1)c1ccc(C(F)(F)F)cn1.
What is the InChIKey of 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine?
The InChIKey is ZBXWJSYVNHKMDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F3N2O3S/c22-21(23,24)17-6-11-20(25-16-17)30(27,28)19-9-7-18(8-10-19)29-15-5-4-14-26-12-2-1-3-13-26/h1-2,6-11,16H,3-5,12-15H2.
What are the key properties of 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine?
2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine has a molecular weight of 440.49 g/mol, XLogP of 4.35, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(3,6-dihydro-2H-pyridin-1-yl)butoxy]phenyl]sulfonyl-5-(trifluoromethyl)pyridine is sourced from PubChem (CID 23393370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).