About dimethyl(propa-1,2-dienyl)borane
dimethyl(propa-1,2-dienyl)borane (PubChem CID 23393411) has the molecular formula C5H9B
and a molecular weight of 79.94 g/mol. Its IUPAC name is dimethyl(propa-1,2-dienyl)borane.
Molecular Properties
| Compound Name | dimethyl(propa-1,2-dienyl)borane |
| PubChem CID | 23393411 |
| Molecular Formula | C5H9B |
| Molecular Weight | 79.94 g/mol |
| Exact Mass | 80.08 |
| IUPAC Name | dimethyl(propa-1,2-dienyl)borane |
| SMILES | C=C=CB(C)C |
| InChI | InChI=1S/C5H9B/c1-4-5-6(2)3/h5H,1H2,2-3H3 |
| InChIKey | IHGAMSMGQVTTHE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 79.94 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(propa-1,2-dienyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(propa-1,2-dienyl)borane?
The IUPAC name of dimethyl(propa-1,2-dienyl)borane (CID 23393411) is dimethyl(propa-1,2-dienyl)borane.
What is the SMILES notation for dimethyl(propa-1,2-dienyl)borane?
The canonical SMILES for dimethyl(propa-1,2-dienyl)borane is C=C=CB(C)C.
What is the InChIKey of dimethyl(propa-1,2-dienyl)borane?
The InChIKey is IHGAMSMGQVTTHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9B/c1-4-5-6(2)3/h5H,1H2,2-3H3.
What are the key properties of dimethyl(propa-1,2-dienyl)borane?
dimethyl(propa-1,2-dienyl)borane has a molecular weight of 79.94 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(propa-1,2-dienyl)borane is sourced from PubChem (CID 23393411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).