About bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate
bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate (PubChem CID 23393611) has the molecular formula C24H33NO9S
and a molecular weight of 511.59 g/mol. Its IUPAC name is bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate |
| PubChem CID | 23393611 |
| Molecular Formula | C24H33NO9S |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate |
| SMILES | O=C(OCCC1CCCCC1)c1ccc(SOOO)c(C(=O)OCCC2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H33NO9S/c26-23(31-15-13-17-7-3-1-4-8-17)19-11-12-20(35-34-33-30)21(22(19)25(28)29)24(27)32-16-14-18-9-5-2-6-10-18/h11-12,17-18,30H,1-10,13-16H2 |
| InChIKey | ZCOYJNTVESDFMR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate?
The IUPAC name of bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate (CID 23393611) is bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate.
What is the SMILES notation for bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate?
The canonical SMILES for bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate is O=C(OCCC1CCCCC1)c1ccc(SOOO)c(C(=O)OCCC2CCCCC2)c1[N+](=O)[O-].
What is the InChIKey of bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate?
The InChIKey is ZCOYJNTVESDFMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33NO9S/c26-23(31-15-13-17-7-3-1-4-8-17)19-11-12-20(35-34-33-30)21(22(19)25(28)29)24(27)32-16-14-18-9-5-2-6-10-18/h11-12,17-18,30H,1-10,13-16H2.
What are the key properties of bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate?
bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate has a molecular weight of 511.59 g/mol, XLogP of 6.28, 12 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-cyclohexylethyl) 2-nitro-4-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate is sourced from PubChem (CID 23393611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).