C24H24F4N2O2 — CID 23393744
1-(2,3,4,5-tetrafluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate (PubChem CID 23393744) has the molecular formula C24H24F4N2O2 and a molecular weight of 448.46 g/mol. Its IUPAC name is 1-(2,3,4,5-tetrafluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate.
| Compound Name | 1-(2,3,4,5-tetrafluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 23393744 |
| Molecular Formula | C24H24F4N2O2 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1-(2,3,4,5-tetrafluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2ccc(CCN3CCCC3)cc2c1C(=O)OC(C)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H24F4N2O2/c1-13-20(24(31)32-14(2)16-12-18(25)22(27)23(28)21(16)26)17-11-15(5-6-19(17)29-13)7-10-30-8-3-4-9-30/h5-6,11-12,14,29H,3-4,7-10H2,1-2H3 |
| InChIKey | ILMMIUSKKQVINY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|