About 1-methyl-4-propyl-1,2,4-triazolidine-3-thione
1-methyl-4-propyl-1,2,4-triazolidine-3-thione (PubChem CID 23394709) has the molecular formula C6H13N3S
and a molecular weight of 159.26 g/mol. Its IUPAC name is 1-methyl-4-propyl-1,2,4-triazolidine-3-thione.
Molecular Properties
| Compound Name | 1-methyl-4-propyl-1,2,4-triazolidine-3-thione |
| PubChem CID | 23394709 |
| Molecular Formula | C6H13N3S |
| Molecular Weight | 159.26 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 1-methyl-4-propyl-1,2,4-triazolidine-3-thione |
| SMILES | CCCN1CN(C)NC1=S |
| InChI | InChI=1S/C6H13N3S/c1-3-4-9-5-8(2)7-6(9)10/h3-5H2,1-2H3,(H,7,10) |
| InChIKey | PIFXWUQPPPSNKN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-propyl-1,2,4-triazolidine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propyl-1,2,4-triazolidine-3-thione?
The IUPAC name of 1-methyl-4-propyl-1,2,4-triazolidine-3-thione (CID 23394709) is 1-methyl-4-propyl-1,2,4-triazolidine-3-thione.
What is the SMILES notation for 1-methyl-4-propyl-1,2,4-triazolidine-3-thione?
The canonical SMILES for 1-methyl-4-propyl-1,2,4-triazolidine-3-thione is CCCN1CN(C)NC1=S.
What is the InChIKey of 1-methyl-4-propyl-1,2,4-triazolidine-3-thione?
The InChIKey is PIFXWUQPPPSNKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3S/c1-3-4-9-5-8(2)7-6(9)10/h3-5H2,1-2H3,(H,7,10).
What are the key properties of 1-methyl-4-propyl-1,2,4-triazolidine-3-thione?
1-methyl-4-propyl-1,2,4-triazolidine-3-thione has a molecular weight of 159.26 g/mol, XLogP of 0.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propyl-1,2,4-triazolidine-3-thione is sourced from PubChem (CID 23394709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).