4-methyl-2-propan-2-yltetradecanoic acid

C18H36O2 — CID 23394746

IUPAC4-methyl-2-propan-2-yltetradecanoic acid
SMILESCCCCCCCCCCC(C)CC(C(=O)O)C(C)C
InChIInChI=1S/C18H36O2/c1-5-6-7-8-9-10-11-12-13-16(4)14-17(15(2)3)18(19)20/h15-17H,5-14H2,1-4H3,(H,19,20)
InChIKeyZTOXNSMBILLSPP-UHFFFAOYSA-N
MW284.48 g/mol
LogP5.90
Rot. Bonds13

About 4-methyl-2-propan-2-yltetradecanoic acid

4-methyl-2-propan-2-yltetradecanoic acid (PubChem CID 23394746) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is 4-methyl-2-propan-2-yltetradecanoic acid.

Molecular Properties

Compound Name4-methyl-2-propan-2-yltetradecanoic acid
PubChem CID23394746
Molecular FormulaC18H36O2
Molecular Weight284.48 g/mol
Exact Mass284.27
IUPAC Name4-methyl-2-propan-2-yltetradecanoic acid
SMILESCCCCCCCCCCC(C)CC(C(=O)O)C(C)C
InChIInChI=1S/C18H36O2/c1-5-6-7-8-9-10-11-12-13-16(4)14-17(15(2)3)18(19)20/h15-17H,5-14H2,1-4H3,(H,19,20)
InChIKeyZTOXNSMBILLSPP-UHFFFAOYSA-N
XLogP5.90
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms20
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500284.48
LogP ≤ 55.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-methyl-2-propan-2-yltetradecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-2-propan-2-yltetradecanoic acid?
The IUPAC name of 4-methyl-2-propan-2-yltetradecanoic acid (CID 23394746) is 4-methyl-2-propan-2-yltetradecanoic acid.
What is the SMILES notation for 4-methyl-2-propan-2-yltetradecanoic acid?
The canonical SMILES for 4-methyl-2-propan-2-yltetradecanoic acid is CCCCCCCCCCC(C)CC(C(=O)O)C(C)C.
What is the InChIKey of 4-methyl-2-propan-2-yltetradecanoic acid?
The InChIKey is ZTOXNSMBILLSPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2/c1-5-6-7-8-9-10-11-12-13-16(4)14-17(15(2)3)18(19)20/h15-17H,5-14H2,1-4H3,(H,19,20).
What are the key properties of 4-methyl-2-propan-2-yltetradecanoic acid?
4-methyl-2-propan-2-yltetradecanoic acid has a molecular weight of 284.48 g/mol, XLogP of 5.90, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-propan-2-yltetradecanoic acid is sourced from PubChem (CID 23394746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).