About 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate
4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate (PubChem CID 23394792) has the molecular formula C4H11N4S-
and a molecular weight of 147.23 g/mol. Its IUPAC name is 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate.
Molecular Properties
| Compound Name | 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate |
| PubChem CID | 23394792 |
| Molecular Formula | C4H11N4S- |
| Molecular Weight | 147.23 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate |
| SMILES | CCN1CN(N)C([S-])N1 |
| InChI | InChI=1S/C4H12N4S/c1-2-7-3-8(5)4(9)6-7/h4,6,9H,2-3,5H2,1H3/p-1 |
| InChIKey | HMOHWZYNUMANCR-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.23 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate?
The IUPAC name of 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate (CID 23394792) is 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate.
What is the SMILES notation for 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate?
The canonical SMILES for 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate is CCN1CN(N)C([S-])N1.
What is the InChIKey of 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate?
The InChIKey is HMOHWZYNUMANCR-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H12N4S/c1-2-7-3-8(5)4(9)6-7/h4,6,9H,2-3,5H2,1H3/p-1.
What are the key properties of 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate?
4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate has a molecular weight of 147.23 g/mol, XLogP of -1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-ethyl-1,2,4-triazolidine-3-thiolate is sourced from PubChem (CID 23394792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).