C15H15NO5 — CID 23395064
(3aR,4S,7R,7aS)-2-(3-hydroxy-4-methoxyphenyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 23395064) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-2-(3-hydroxy-4-methoxyphenyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aS)-2-(3-hydroxy-4-methoxyphenyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 23395064 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (3aR,4S,7R,7aS)-2-(3-hydroxy-4-methoxyphenyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)cc1O |
| InChI | InChI=1S/C15H15NO5/c1-20-9-3-2-7(6-8(9)17)16-14(18)12-10-4-5-11(21-10)13(12)15(16)19/h2-3,6,10-13,17H,4-5H2,1H3/t10-,11+,12-,13+ |
| InChIKey | ZYXSVFDFSCLIQC-MPZDIEGVSA-N |
| XLogP | 1.07 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|