C27H33N3O5Si — CID 23395116
5-[(3aS,4S,5R,7S,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-4-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile (PubChem CID 23395116) has the molecular formula C27H33N3O5Si and a molecular weight of 507.66 g/mol. Its IUPAC name is 5-[(3aS,4S,5R,7S,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-4-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(3aS,4S,5R,7S,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-4-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 23395116 |
| Molecular Formula | C27H33N3O5Si |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 5-[(3aS,4S,5R,7S,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-4-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@]12C[C@@H](O)[C@@](C)(O1)[C@H]1C(=O)N(c3ccc(C#N)c4ncccc34)C(=O)[C@H]12 |
| InChI | InChI=1S/C27H33N3O5Si/c1-25(2,3)36(5,6)34-13-11-27-14-19(31)26(4,35-27)20-21(27)24(33)30(23(20)32)18-10-9-16(15-28)22-17(18)8-7-12-29-22/h7-10,12,19-21,31H,11,13-14H2,1-6H3/t19-,20-,21+,26-,27+/m1/s1 |
| InChIKey | JWBKXXDHKRFRTI-WOSPUIJPSA-N |
| XLogP | 3.92 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|