C12H16IN — CID 23395444
7-iodo-5,8-dimethyl-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 23395444) has the molecular formula C12H16IN and a molecular weight of 301.17 g/mol. Its IUPAC name is 7-iodo-5,8-dimethyl-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | 7-iodo-5,8-dimethyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 23395444 |
| Molecular Formula | C12H16IN |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 7-iodo-5,8-dimethyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | Cc1cc2c(cc1I)C(C)CNCC2 |
| InChI | InChI=1S/C12H16IN/c1-8-5-10-3-4-14-7-9(2)11(10)6-12(8)13/h5-6,9,14H,3-4,7H2,1-2H3 |
| InChIKey | YZDVAVFQFXNDIM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|