About 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+)
3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+) (PubChem CID 23395992) has the molecular formula C10H12NO2Y+2
and a molecular weight of 267.12 g/mol. Its IUPAC name is 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+).
Molecular Properties
| Compound Name | 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+) |
| PubChem CID | 23395992 |
| Molecular Formula | C10H12NO2Y+2 |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+) |
| SMILES | CCc1[c-]c(C)c(C)nc1C(=O)O.[Y+3] |
| InChI | InChI=1S/C10H12NO2.Y/c1-4-8-5-6(2)7(3)11-9(8)10(12)13;/h4H2,1-3H3,(H,12,13);/q-1;+3 |
| InChIKey | YLGDOZOQENCEOW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+)?
The IUPAC name of 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+) (CID 23395992) is 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+).
What is the SMILES notation for 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+)?
The canonical SMILES for 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+) is CCc1[c-]c(C)c(C)nc1C(=O)O.[Y+3].
What is the InChIKey of 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+)?
The InChIKey is YLGDOZOQENCEOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12NO2.Y/c1-4-8-5-6(2)7(3)11-9(8)10(12)13;/h4H2,1-3H3,(H,12,13);/q-1;+3.
What are the key properties of 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+)?
3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+) has a molecular weight of 267.12 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5,6-dimethyl-4H-pyridin-4-ide-2-carboxylic acid;yttrium(3+) is sourced from PubChem (CID 23395992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).