C27H30ClN3O2 — CID 23396288
4-chloro-3-[2-(4-methylphenyl)ethoxy]-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide (PubChem CID 23396288) has the molecular formula C27H30ClN3O2 and a molecular weight of 464.01 g/mol. Its IUPAC name is 4-chloro-3-[2-(4-methylphenyl)ethoxy]-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide.
| Compound Name | 4-chloro-3-[2-(4-methylphenyl)ethoxy]-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 23396288 |
| Molecular Formula | C27H30ClN3O2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 4-chloro-3-[2-(4-methylphenyl)ethoxy]-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide |
| SMILES | Cc1ccc(CCOc2cc(C(=O)NCC3CCN(c4ccncc4)CC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C27H30ClN3O2/c1-20-2-4-21(5-3-20)12-17-33-26-18-23(6-7-25(26)28)27(32)30-19-22-10-15-31(16-11-22)24-8-13-29-14-9-24/h2-9,13-14,18,22H,10-12,15-17,19H2,1H3,(H,30,32) |
| InChIKey | MYMXDIMTTAYBBP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |