C29H32F2N4O5S — CID 23396471
N-[4-[4-[(2,6-difluorophenyl)methylcarbamoyl]-5,5-dimethyl-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 23396471) has the molecular formula C29H32F2N4O5S and a molecular weight of 586.66 g/mol. Its IUPAC name is N-[4-[4-[(2,6-difluorophenyl)methylcarbamoyl]-5,5-dimethyl-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-3,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[4-[4-[(2,6-difluorophenyl)methylcarbamoyl]-5,5-dimethyl-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23396471 |
| Molecular Formula | C29H32F2N4O5S |
| Molecular Weight | 586.66 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | N-[4-[4-[(2,6-difluorophenyl)methylcarbamoyl]-5,5-dimethyl-1,3-thiazolidin-3-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)NC(Cc1ccccc1)C(O)C(=O)N1CSC(C)(C)C1C(=O)NCc1c(F)cccc1F |
| InChI | InChI=1S/C29H32F2N4O5S/c1-16-23(17(2)40-34-16)26(37)33-22(13-18-9-6-5-7-10-18)24(36)28(39)35-15-41-29(3,4)25(35)27(38)32-14-19-20(30)11-8-12-21(19)31/h5-12,22,24-25,36H,13-15H2,1-4H3,(H,32,38)(H,33,37) |
| InChIKey | KQZWRWVSJHMWDR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |