C31H36N4O5S — CID 23396531
N-[(4-aminophenyl)methyl]-3-[2-hydroxy-3-[(3-hydroxy-2-methylbenzoyl)amino]-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 23396531) has the molecular formula C31H36N4O5S and a molecular weight of 576.72 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-3-[2-hydroxy-3-[(3-hydroxy-2-methylbenzoyl)amino]-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[(4-aminophenyl)methyl]-3-[2-hydroxy-3-[(3-hydroxy-2-methylbenzoyl)amino]-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 23396531 |
| Molecular Formula | C31H36N4O5S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-3-[2-hydroxy-3-[(3-hydroxy-2-methylbenzoyl)amino]-4-phenylbutanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1c(O)cccc1C(=O)NC(Cc1ccccc1)C(O)C(=O)N1CSC(C)(C)C1C(=O)NCc1ccc(N)cc1 |
| InChI | InChI=1S/C31H36N4O5S/c1-19-23(10-7-11-25(19)36)28(38)34-24(16-20-8-5-4-6-9-20)26(37)30(40)35-18-41-31(2,3)27(35)29(39)33-17-21-12-14-22(32)15-13-21/h4-15,24,26-27,36-37H,16-18,32H2,1-3H3,(H,33,39)(H,34,38) |
| InChIKey | YRDPAAUHWMBPTL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|