About 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine
4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine (PubChem CID 23396987) has the molecular formula C11H14ClN
and a molecular weight of 195.69 g/mol. Its IUPAC name is 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine.
Molecular Properties
| Compound Name | 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine |
| PubChem CID | 23396987 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCNC1Cc2cccc(Cl)c2C1 |
| InChI | InChI=1S/C11H14ClN/c1-2-13-9-6-8-4-3-5-11(12)10(8)7-9/h3-5,9,13H,2,6-7H2,1H3 |
| InChIKey | OSFKMGBNFSQCOJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine?
The IUPAC name of 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine (CID 23396987) is 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine.
What is the SMILES notation for 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine?
The canonical SMILES for 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine is CCNC1Cc2cccc(Cl)c2C1.
What is the InChIKey of 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine?
The InChIKey is OSFKMGBNFSQCOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN/c1-2-13-9-6-8-4-3-5-11(12)10(8)7-9/h3-5,9,13H,2,6-7H2,1H3.
What are the key properties of 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine?
4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine has a molecular weight of 195.69 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-ethyl-2,3-dihydro-1H-inden-2-amine is sourced from PubChem (CID 23396987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).