C21H16ClN3O3 — CID 23397126
2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-oxazol-5-yl)-2-oxoacetamide (PubChem CID 23397126) has the molecular formula C21H16ClN3O3 and a molecular weight of 393.83 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-oxazol-5-yl)-2-oxoacetamide.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-oxazol-5-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 23397126 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-N-(3-methyl-1,2-oxazol-5-yl)-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)c2cn(Cc3ccc(Cl)cc3)c3ccccc23)on1 |
| InChI | InChI=1S/C21H16ClN3O3/c1-13-10-19(28-24-13)23-21(27)20(26)17-12-25(18-5-3-2-4-16(17)18)11-14-6-8-15(22)9-7-14/h2-10,12H,11H2,1H3,(H,23,27) |
| InChIKey | AYEHOGHSMUDJPU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|