C17H23NO5 — CID 23397459
benzyl N-(3,3-dimethoxy-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan-3a-yl)carbamate (PubChem CID 23397459) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is benzyl N-(3,3-dimethoxy-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan-3a-yl)carbamate.
| Compound Name | benzyl N-(3,3-dimethoxy-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan-3a-yl)carbamate |
|---|---|
| PubChem CID | 23397459 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | benzyl N-(3,3-dimethoxy-4,5,6,6a-tetrahydro-2H-cyclopenta[b]furan-3a-yl)carbamate |
| SMILES | COC1(OC)COC2CCCC21NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO5/c1-20-17(21-2)12-23-14-9-6-10-16(14,17)18-15(19)22-11-13-7-4-3-5-8-13/h3-5,7-8,14H,6,9-12H2,1-2H3,(H,18,19) |
| InChIKey | WUGDICILWVZWFG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|