About 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one
4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one (PubChem CID 23398291) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one |
| PubChem CID | 23398291 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one |
| SMILES | CN1CCC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C14H25NO/c1-13(2,3)10-8-9-15(7)12(16)11(10)14(4,5)6/h8-9H2,1-7H3 |
| InChIKey | HKMUFWOHZLSERT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one?
The IUPAC name of 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one (CID 23398291) is 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one.
What is the SMILES notation for 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one?
The canonical SMILES for 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one is CN1CCC(C(C)(C)C)=C(C(C)(C)C)C1=O.
What is the InChIKey of 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one?
The InChIKey is HKMUFWOHZLSERT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c1-13(2,3)10-8-9-15(7)12(16)11(10)14(4,5)6/h8-9H2,1-7H3.
What are the key properties of 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one?
4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one has a molecular weight of 223.36 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-ditert-butyl-1-methyl-2,3-dihydropyridin-6-one is sourced from PubChem (CID 23398291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).