About 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole
2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole (PubChem CID 23399459) has the molecular formula C27H15N3S3
and a molecular weight of 477.64 g/mol. Its IUPAC name is 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole |
| PubChem CID | 23399459 |
| Molecular Formula | C27H15N3S3 |
| Molecular Weight | 477.64 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(-c3cc(-c4nc5ccccc5s4)cc(-c4nc5ccccc5s4)c3)nc2c1 |
| InChI | InChI=1S/C27H15N3S3/c1-4-10-22-19(7-1)28-25(31-22)16-13-17(26-29-20-8-2-5-11-23(20)32-26)15-18(14-16)27-30-21-9-3-6-12-24(21)33-27/h1-15H |
| InChIKey | HEIPKWLZBUOTFR-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.64 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole?
The IUPAC name of 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole (CID 23399459) is 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole?
The canonical SMILES for 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole is c1ccc2sc(-c3cc(-c4nc5ccccc5s4)cc(-c4nc5ccccc5s4)c3)nc2c1.
What is the InChIKey of 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole?
The InChIKey is HEIPKWLZBUOTFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H15N3S3/c1-4-10-22-19(7-1)28-25(31-22)16-13-17(26-29-20-8-2-5-11-23(20)32-26)15-18(14-16)27-30-21-9-3-6-12-24(21)33-27/h1-15H.
What are the key properties of 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole?
2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole has a molecular weight of 477.64 g/mol, XLogP of 8.52, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(1,3-benzothiazol-2-yl)phenyl]-1,3-benzothiazole is sourced from PubChem (CID 23399459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).