C45H30N6S3 — CID 23399507
2-[2-[2,4,6-trimethyl-3,5-bis[2-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 23399507) has the molecular formula C45H30N6S3 and a molecular weight of 750.98 g/mol. Its IUPAC name is 2-[2-[2,4,6-trimethyl-3,5-bis[2-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-[2-[2,4,6-trimethyl-3,5-bis[2-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 23399507 |
| Molecular Formula | C45H30N6S3 |
| Molecular Weight | 750.98 g/mol |
| Exact Mass | 750.17 |
| IUPAC Name | 2-[2-[2,4,6-trimethyl-3,5-bis[2-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | Cc1c(-c2ccccc2-c2nc3cccnc3s2)c(C)c(-c2ccccc2-c2nc3cccnc3s2)c(C)c1-c1ccccc1-c1nc2cccnc2s1 |
| InChI | InChI=1S/C45H30N6S3/c1-25-37(28-13-4-7-16-31(28)40-49-34-19-10-22-46-43(34)52-40)26(2)39(30-15-6-9-18-33(30)42-51-36-21-12-24-48-45(36)54-42)27(3)38(25)29-14-5-8-17-32(29)41-50-35-20-11-23-47-44(35)53-41/h4-24H,1-3H3 |
| InChIKey | VECYMVMBLNTCIE-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.98 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |