C32H18N8S4 — CID 23399514
2-[2,5-dimethyl-3,4,6-tris([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 23399514) has the molecular formula C32H18N8S4 and a molecular weight of 642.82 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3,4,6-tris([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-[2,5-dimethyl-3,4,6-tris([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 23399514 |
| Molecular Formula | C32H18N8S4 |
| Molecular Weight | 642.82 g/mol |
| Exact Mass | 642.05 |
| IUPAC Name | 2-[2,5-dimethyl-3,4,6-tris([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | Cc1c(-c2nc3cccnc3s2)c(-c2nc3cccnc3s2)c(C)c(-c2nc3cccnc3s2)c1-c1nc2cccnc2s1 |
| InChI | InChI=1S/C32H18N8S4/c1-15-21(29-37-17-7-3-11-33-25(17)41-29)23(31-39-19-9-5-13-35-27(19)43-31)16(2)24(32-40-20-10-6-14-36-28(20)44-32)22(15)30-38-18-8-4-12-34-26(18)42-30/h3-14H,1-2H3 |
| InChIKey | LKILQMBNTWWJEJ-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.82 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |