C48H36N6O3 — CID 23399520
2-[3-methyl-2-[2,4,6-trimethyl-3,5-bis[2-methyl-6-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 23399520) has the molecular formula C48H36N6O3 and a molecular weight of 744.86 g/mol. Its IUPAC name is 2-[3-methyl-2-[2,4,6-trimethyl-3,5-bis[2-methyl-6-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 2-[3-methyl-2-[2,4,6-trimethyl-3,5-bis[2-methyl-6-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 23399520 |
| Molecular Formula | C48H36N6O3 |
| Molecular Weight | 744.86 g/mol |
| Exact Mass | 744.28 |
| IUPAC Name | 2-[3-methyl-2-[2,4,6-trimethyl-3,5-bis[2-methyl-6-([1,3]oxazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]phenyl]-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Cc1cccc(-c2nc3cccnc3o2)c1-c1c(C)c(-c2c(C)cccc2-c2nc3cccnc3o2)c(C)c(-c2c(C)cccc2-c2nc3cccnc3o2)c1C |
| InChI | InChI=1S/C48H36N6O3/c1-25-13-7-16-31(43-52-34-19-10-22-49-46(34)55-43)37(25)40-28(4)41(38-26(2)14-8-17-32(38)44-53-35-20-11-23-50-47(35)56-44)30(6)42(29(40)5)39-27(3)15-9-18-33(39)45-54-36-21-12-24-51-48(36)57-45/h7-24H,1-6H3 |
| InChIKey | NBEODRPFMLOTKI-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 116.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.86 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |