C32H46F6O8 — CID 23399651
tert-butyl 5-methyl-4-[3,3,3-trifluoro-2-methoxycarbonyl-2-[2-(3,3,3-trifluoro-2-methoxycarbonyl-2-methylpropyl)oxan-3-yl]propyl]-3-oxatricyclo[6.2.1.02,7]undecane-10-carboxylate (PubChem CID 23399651) has the molecular formula C32H46F6O8 and a molecular weight of 672.70 g/mol. Its IUPAC name is tert-butyl 5-methyl-4-[3,3,3-trifluoro-2-methoxycarbonyl-2-[2-(3,3,3-trifluoro-2-methoxycarbonyl-2-methylpropyl)oxan-3-yl]propyl]-3-oxatricyclo[6.2.1.02,7]undecane-10-carboxylate.
| Compound Name | tert-butyl 5-methyl-4-[3,3,3-trifluoro-2-methoxycarbonyl-2-[2-(3,3,3-trifluoro-2-methoxycarbonyl-2-methylpropyl)oxan-3-yl]propyl]-3-oxatricyclo[6.2.1.02,7]undecane-10-carboxylate |
|---|---|
| PubChem CID | 23399651 |
| Molecular Formula | C32H46F6O8 |
| Molecular Weight | 672.70 g/mol |
| Exact Mass | 672.31 |
| IUPAC Name | tert-butyl 5-methyl-4-[3,3,3-trifluoro-2-methoxycarbonyl-2-[2-(3,3,3-trifluoro-2-methoxycarbonyl-2-methylpropyl)oxan-3-yl]propyl]-3-oxatricyclo[6.2.1.02,7]undecane-10-carboxylate |
| SMILES | COC(=O)C(C)(CC1OCCCC1C(CC1OC2C(CC1C)C1CC(C(=O)OC(C)(C)C)C2C1)(C(=O)OC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C32H46F6O8/c1-16-11-18-17-12-19(20(13-17)25(39)46-28(2,3)4)24(18)45-22(16)15-30(27(41)43-7,32(36,37)38)21-9-8-10-44-23(21)14-29(5,26(40)42-6)31(33,34)35/h16-24H,8-15H2,1-7H3 |
| InChIKey | BLCAIUXWJRDNNJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.70 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|