About 4-(furan-2-yl)butan-2-ol
4-(furan-2-yl)butan-2-ol (PubChem CID 23400) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 4-(furan-2-yl)butan-2-ol.
Molecular Properties
| Compound Name | 4-(furan-2-yl)butan-2-ol |
| PubChem CID | 23400 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 4-(furan-2-yl)butan-2-ol |
| SMILES | CC(O)CCc1ccco1 |
| InChI | InChI=1S/C8H12O2/c1-7(9)4-5-8-3-2-6-10-8/h2-3,6-7,9H,4-5H2,1H3 |
| InChIKey | WJKRHTCMSSXHNV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(furan-2-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)butan-2-ol?
The IUPAC name of 4-(furan-2-yl)butan-2-ol (CID 23400) is 4-(furan-2-yl)butan-2-ol.
What is the SMILES notation for 4-(furan-2-yl)butan-2-ol?
The canonical SMILES for 4-(furan-2-yl)butan-2-ol is CC(O)CCc1ccco1.
What is the InChIKey of 4-(furan-2-yl)butan-2-ol?
The InChIKey is WJKRHTCMSSXHNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-7(9)4-5-8-3-2-6-10-8/h2-3,6-7,9H,4-5H2,1H3.
What are the key properties of 4-(furan-2-yl)butan-2-ol?
4-(furan-2-yl)butan-2-ol has a molecular weight of 140.18 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)butan-2-ol is sourced from PubChem (CID 23400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).