C34H35N5O5 — CID 23400636
ethyl 2-[18-(cyanomethyl)-12-(isocyanomethyl)-22-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-8-yl]-1H-indole-6-carboxylate (PubChem CID 23400636) has the molecular formula C34H35N5O5 and a molecular weight of 593.68 g/mol. Its IUPAC name is ethyl 2-[18-(cyanomethyl)-12-(isocyanomethyl)-22-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-8-yl]-1H-indole-6-carboxylate.
| Compound Name | ethyl 2-[18-(cyanomethyl)-12-(isocyanomethyl)-22-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-8-yl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 23400636 |
| Molecular Formula | C34H35N5O5 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | ethyl 2-[18-(cyanomethyl)-12-(isocyanomethyl)-22-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-8-yl]-1H-indole-6-carboxylate |
| SMILES | [C-]#[N+]CN1CCOCCN(CC#N)c2ccc(C)cc2OCCOc2cc(-c3cc4ccc(C(=O)OCC)cc4[nH]3)ccc21 |
| InChI | InChI=1S/C34H35N5O5/c1-4-42-34(40)27-7-6-25-20-28(37-29(25)21-27)26-8-10-31-33(22-26)44-18-17-43-32-19-24(2)5-9-30(32)38(12-11-35)13-15-41-16-14-39(31)23-36-3/h5-10,19-22,37H,4,12-18,23H2,1-2H3 |
| InChIKey | OXLUBKLWJSBXIV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|