C22H50N6O — CID 23400698
2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(4-methylpentan-2-ylamino)hexanamide (PubChem CID 23400698) has the molecular formula C22H50N6O and a molecular weight of 414.68 g/mol. Its IUPAC name is 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(4-methylpentan-2-ylamino)hexanamide.
| Compound Name | 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(4-methylpentan-2-ylamino)hexanamide |
|---|---|
| PubChem CID | 23400698 |
| Molecular Formula | C22H50N6O |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.40 |
| IUPAC Name | 2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(4-methylpentan-2-ylamino)hexanamide |
| SMILES | CC(C)CC(C)NCCCCC(N)C(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C22H50N6O/c1-19(2)18-20(3)27-16-5-4-10-21(24)22(29)28-17-9-15-26-13-7-6-12-25-14-8-11-23/h19-21,25-27H,4-18,23-24H2,1-3H3,(H,28,29) |
| InChIKey | IMBWYJPYJPAETG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|